CAS 1378626-99-3 appears in our catalog under these names: 1-(4-Cyanobenzyl)-3-methyl-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Cyanobenzyl)-3-methyl-1H-pyrazole-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 1g.
1-[(4-cyanophenyl)methyl]-3-methylpyrazole-4-carboxylic acid (CAS 1378626-99-3) is a chemical compound with the molecular formula C13H11N3O2 and a molecular weight of 241.24 g/mol. IUPAC name: 1-[(4-cyanophenyl)methyl]-3-methylpyrazole-4-carboxylic acid. InChIKey: HVLQTKTXQWHECX-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 1-[(4-cyanophenyl)methyl]-3-methylpyrazole-4-carboxylic acid |
| InChIKey | HVLQTKTXQWHECX-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C(=O)O)CC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)