Products 1211518-37-4

CAS 1211518-37-4 appears in our catalog under these names: (4-(Difluoromethyl)phenyl)methanesulfonyl chloride, (4-(Difluoromethyl)phenyl)methanesulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

[4-(difluoromethyl)phenyl]methanesulfonyl chloride (CAS 1211518-37-4) is a chemical compound with the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. IUPAC name: [4-(difluoromethyl)phenyl]methanesulfonyl chloride. InChIKey: VKSCZUPWXLIQFV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClF2O2S
Molecular weight240.66 g/mol
IUPAC name[4-(difluoromethyl)phenyl]methanesulfonyl chloride
InChIKeyVKSCZUPWXLIQFV-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CS(=O)(=O)Cl)C(F)F

Computed by PubChem (NCBI)