CAS 1354949-96-4 is the registry number for 1-(Chloromethyl)-4-difluoromethanesulfonylbenzene. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.
1-(chloromethyl)-4-(difluoromethylsulfonyl)benzene (CAS 1354949-96-4) is a chemical compound with the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. IUPAC name: 1-(chloromethyl)-4-(difluoromethylsulfonyl)benzene. InChIKey: RYKZUMZCNPGQAC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2O2S |
|---|---|
| Molecular weight | 240.66 g/mol |
| IUPAC name | 1-(chloromethyl)-4-(difluoromethylsulfonyl)benzene |
| InChIKey | RYKZUMZCNPGQAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)S(=O)(=O)C(F)F |
Computed by PubChem (NCBI)