Products 1782813-28-8

CAS 1782813-28-8 appears in our catalog under these names: 2-(1,1-Difluoroethyl)benzenesulfonyl chloride, 98%, 2-(1,1-Difluoroethyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(1,1-difluoroethyl)benzenesulfonyl chloride (CAS 1782813-28-8) is a chemical compound with the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. IUPAC name: 2-(1,1-difluoroethyl)benzenesulfonyl chloride. InChIKey: YTAASPNHFRBFRN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClF2O2S
Molecular weight240.66 g/mol
IUPAC name2-(1,1-difluoroethyl)benzenesulfonyl chloride
InChIKeyYTAASPNHFRBFRN-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1S(=O)(=O)Cl)(F)F

Computed by PubChem (NCBI)