CAS 1782813-28-8 appears in our catalog under these names: 2-(1,1-Difluoroethyl)benzenesulfonyl chloride, 98%, 2-(1,1-Difluoroethyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(1,1-difluoroethyl)benzenesulfonyl chloride (CAS 1782813-28-8) is a chemical compound with the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. IUPAC name: 2-(1,1-difluoroethyl)benzenesulfonyl chloride. InChIKey: YTAASPNHFRBFRN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2O2S |
|---|---|
| Molecular weight | 240.66 g/mol |
| IUPAC name | 2-(1,1-difluoroethyl)benzenesulfonyl chloride |
| InChIKey | YTAASPNHFRBFRN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1S(=O)(=O)Cl)(F)F |
Computed by PubChem (NCBI)