CAS 1782576-12-8 is the registry number for 4-(1,1-Difluoroethyl)benzene-1-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4-(1,1-difluoroethyl)benzenesulfonyl chloride (CAS 1782576-12-8) is a chemical compound with the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. IUPAC name: 4-(1,1-difluoroethyl)benzenesulfonyl chloride. InChIKey: HIPMRARAXOHAEY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2O2S |
|---|---|
| Molecular weight | 240.66 g/mol |
| IUPAC name | 4-(1,1-difluoroethyl)benzenesulfonyl chloride |
| InChIKey | HIPMRARAXOHAEY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)S(=O)(=O)Cl)(F)F |
Computed by PubChem (NCBI)