Products 1564905-81-2

CAS 1564905-81-2 is the registry number for 2-(2,6-Difluorophenyl)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(2,6-difluorophenyl)ethanesulfonyl chloride (CAS 1564905-81-2) is a chemical compound with the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. IUPAC name: 2-(2,6-difluorophenyl)ethanesulfonyl chloride. InChIKey: FUFBQWQNKRRDEH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClF2O2S
Molecular weight240.66 g/mol
IUPAC name2-(2,6-difluorophenyl)ethanesulfonyl chloride
InChIKeyFUFBQWQNKRRDEH-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)CCS(=O)(=O)Cl)F

Computed by PubChem (NCBI)