CAS 1564905-81-2 is the registry number for 2-(2,6-Difluorophenyl)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(2,6-difluorophenyl)ethanesulfonyl chloride (CAS 1564905-81-2) is a chemical compound with the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. IUPAC name: 2-(2,6-difluorophenyl)ethanesulfonyl chloride. InChIKey: FUFBQWQNKRRDEH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2O2S |
|---|---|
| Molecular weight | 240.66 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)ethanesulfonyl chloride |
| InChIKey | FUFBQWQNKRRDEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CCS(=O)(=O)Cl)F |
Computed by PubChem (NCBI)