CAS 1597429-54-3 appears in our catalog under these names: 3-(1,1-Difluoroethyl)benzene-1-sulfonyl chloride, 3-(1,1-Difluoroethyl)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
3-(1,1-difluoroethyl)benzenesulfonyl chloride (CAS 1597429-54-3) is a chemical compound with the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. IUPAC name: 3-(1,1-difluoroethyl)benzenesulfonyl chloride. InChIKey: NMHZVWQOXJYTPQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2O2S |
|---|---|
| Molecular weight | 240.66 g/mol |
| IUPAC name | 3-(1,1-difluoroethyl)benzenesulfonyl chloride |
| InChIKey | NMHZVWQOXJYTPQ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)S(=O)(=O)Cl)(F)F |
Computed by PubChem (NCBI)