Products 1597429-54-3

CAS 1597429-54-3 appears in our catalog under these names: 3-(1,1-Difluoroethyl)benzene-1-sulfonyl chloride, 3-(1,1-Difluoroethyl)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.

3-(1,1-difluoroethyl)benzenesulfonyl chloride (CAS 1597429-54-3) is a chemical compound with the molecular formula C8H7ClF2O2S and a molecular weight of 240.66 g/mol. IUPAC name: 3-(1,1-difluoroethyl)benzenesulfonyl chloride. InChIKey: NMHZVWQOXJYTPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClF2O2S
Molecular weight240.66 g/mol
IUPAC name3-(1,1-difluoroethyl)benzenesulfonyl chloride
InChIKeyNMHZVWQOXJYTPQ-UHFFFAOYSA-N
SMILESCC(C1=CC(=CC=C1)S(=O)(=O)Cl)(F)F

Computed by PubChem (NCBI)