Products 1211532-15-8
CAS 1211532-15-8 appears in our catalog under these names: 6-Methoxy-5-(trifluoromethyl)nicotinic acid, 95%, 6–Methoxy–5–(trifluoromethyl)nicotinic acid, 6-Methoxy-5-(trifluoromethyl)nicotinic acid, 6-Methoxy-5-(trifluoromethyl)nicotinic acid, 95%, 95%, 6-METHOXY-5-(TRIFLUOROMETHYL)NICOTINIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g.
6-methoxy-5-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1211532-15-8) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 6-methoxy-5-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: RFXPVNUCYNQFSJ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 6-methoxy-5-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | RFXPVNUCYNQFSJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)