CAS 1211548-70-7 appears in our catalog under these names: (S)-4-Hydroxythiochroman 1,1-dioxide, 95%, (4S)-4-Hydroxy-3,4-dihydro-2H-1λâ¶-benzothiopyran-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(4S)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol (CAS 1211548-70-7) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: (4S)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol. InChIKey: HDWSBBCZEGJIPK-QMMMGPOBSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | (4S)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol |
| InChIKey | HDWSBBCZEGJIPK-QMMMGPOBSA-N |
| SMILES | C1CS(=O)(=O)C2=CC=CC=C2[C@H]1O |
Computed by PubChem (NCBI)