CAS 2765-44-8 is the registry number for 4-Hydroxy-3,4-dihydro-2H-1λâ¶-benzothiopyran-1,1-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol (CAS 2765-44-8) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol. InChIKey: HDWSBBCZEGJIPK-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol |
| InChIKey | HDWSBBCZEGJIPK-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=CC=CC=C2C1O |
Computed by PubChem (NCBI)