CAS 1308650-41-0 appears in our catalog under these names: (4R)-4-Hydroxy-3,4-dihydro-2H-1λâ¶-benzothiopyran-1,1-dione, (R)-4-Hydroxythiochroman 1,1-dioxide 95%, (R)-4-Hydroxythiochroman 1,1-dioxide, 98%, 98%, (4R)-4-hydroxy-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1-dione, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 50mg, 100mg, 250mg.
(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol (CAS 1308650-41-0) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol. InChIKey: HDWSBBCZEGJIPK-MRVPVSSYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol |
| InChIKey | HDWSBBCZEGJIPK-MRVPVSSYSA-N |
| SMILES | C1CS(=O)(=O)C2=CC=CC=C2[C@@H]1O |
Computed by PubChem (NCBI)