CAS 1212-08-4 appears in our catalog under these names: S-Phenyl benzenethiosulfonate, 95%, S-Phenyl Benzenethiosulfonate, S–Phenyl Benzenethiosulfonate, S-Phenyl Benzenesulfonothioate, >95.0%(HPLC), Benzenethiosulfonicacids-phenylester 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 10g, 1g, 2,5g, 25g, 100g, 100mg, 250mg.
Benzenesulfonylsulfanylbenzene (CAS 1212-08-4) is a chemical compound with the molecular formula C12H10O2S2 and a molecular weight of 250.3 g/mol. IUPAC name: benzenesulfonylsulfanylbenzene. InChIKey: ATKJLMWDXASAJA-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | benzenesulfonylsulfanylbenzene |
| InChIKey | ATKJLMWDXASAJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)