Products 62688-29-3
CAS 62688-29-3 is the registry number for 2-((Thiophen-3-ylmethyl)thio)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 10g.
2-(thiophen-3-ylmethylsulfanyl)benzoic acid (CAS 62688-29-3) is a chemical compound with the molecular formula C12H10O2S2 and a molecular weight of 250.3 g/mol. IUPAC name: 2-(thiophen-3-ylmethylsulfanyl)benzoic acid. InChIKey: ZNSHPJTYGIZOKH-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 2-(thiophen-3-ylmethylsulfanyl)benzoic acid |
| InChIKey | ZNSHPJTYGIZOKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SCC2=CSC=C2 |
Computed by PubChem (NCBI)
Synonyms:
2-{[(thiophen-3-yl)methyl]sulfanyl}benzoic acid, 2-(((Thiophen-3-yl)methyl)sulfanyl)benzoic acid, 2-[(thien-3-ylmethyl)thio]benzoic acid, 2-(thiophen-3-ylmethylsulfanyl)benzoic Acid, 2-[(thiophen-3-ylmethyl)sulfanyl]benzoic acid, 2-(3-thienylmethylsulfanyl)benzoic acid, 2-((Thiophen-3-ylmethyl)thio)benzoicacid, 2-((Thiophen-3-ylmethyl)thio)benzoic acid