CAS 147951-24-4 is the registry number for 1,2-Bis(3-methylthiophen-2-yl)ethane-1,2-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-bis(3-methylthiophen-2-yl)ethane-1,2-dione (CAS 147951-24-4) is a chemical compound with the molecular formula C12H10O2S2 and a molecular weight of 250.3 g/mol. IUPAC name: 1,2-bis(3-methylthiophen-2-yl)ethane-1,2-dione. InChIKey: GCAXOUZIAQDEHD-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 1,2-bis(3-methylthiophen-2-yl)ethane-1,2-dione |
| InChIKey | GCAXOUZIAQDEHD-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C(=O)C(=O)C2=C(C=CS2)C |
Computed by PubChem (NCBI)