CAS 931353-92-3 is the registry number for 7-Methyl-4,5-dihydrobenzo[1,2-b:3,4-b']dithiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methyl-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxylic acid (CAS 931353-92-3) is a chemical compound with the molecular formula C12H10O2S2 and a molecular weight of 250.3 g/mol. IUPAC name: 7-methyl-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxylic acid. InChIKey: OPUHVOSVZOTRAV-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 7-methyl-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxylic acid |
| InChIKey | OPUHVOSVZOTRAV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)CCC3=C2SC(=C3)C(=O)O |
Computed by PubChem (NCBI)