CAS 21101-56-4 appears in our catalog under these names: 3,3'-Dihydroxydiphenyl disulfide, 98%, 3,3′–Dihydroxydiphenyl disulfide, 3,3-Disulfanediyldiphenol 98%, 3,3'-Dihydroxydiphenyl disulfide, 98%, 98%, 3,3'-DIHYDROXYDIPHENYL DISULFIDE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Sigma-Aldrich. Available pack sizes: 25g, 100g, 1g, 5g, 10g.
3-[(3-hydroxyphenyl)disulfanyl]phenol (CAS 21101-56-4) is a chemical compound with the molecular formula C12H10O2S2 and a molecular weight of 250.3 g/mol. IUPAC name: 3-[(3-hydroxyphenyl)disulfanyl]phenol. InChIKey: XBNOMKROXZGMFW-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 3-[(3-hydroxyphenyl)disulfanyl]phenol |
| InChIKey | XBNOMKROXZGMFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SSC2=CC=CC(=C2)O)O |
Computed by PubChem (NCBI)