CAS 13669-05-1 appears in our catalog under these names: 1,4–Di(2–thienyl)–1,4–butanedione, 1,4-Di(2-thienyl)-1,4-butanedione, >95.0%(GC), 1,4-Di(2-thienyl)-1,4-butanedione 95%, 1,4-Di(2-thienyl)-1,4-butanedione, 95%, 95%, 1,4-bis(thiophen-2-yl)butane-1,4-dione, ≥95%(GC). Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
1,4-dithiophen-2-ylbutane-1,4-dione (CAS 13669-05-1) is a chemical compound with the molecular formula C12H10O2S2 and a molecular weight of 250.3 g/mol. IUPAC name: 1,4-dithiophen-2-ylbutane-1,4-dione. InChIKey: QJGKCQWQNOPAMG-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 1,4-dithiophen-2-ylbutane-1,4-dione |
| InChIKey | QJGKCQWQNOPAMG-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)CCC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)