CAS 1212941-74-6 is the registry number for Boc-L-Tyr(3,5-Me2)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 50mg, 250mg.
(2S)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1212941-74-6) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: (2S)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: SMCPAJFOGLJANB-LBPRGKRZSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | (2S)-3-(4-hydroxy-3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | SMCPAJFOGLJANB-LBPRGKRZSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)