Products 1700567-31-2
CAS 1700567-31-2 is the registry number for Boc-3,5- Dimethyl-DL-Tyrosine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-hydroxy-3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1700567-31-2) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: 3-(4-hydroxy-3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: SMCPAJFOGLJANB-UHFFFAOYSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | 3-(4-hydroxy-3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | SMCPAJFOGLJANB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)