CAS 121385-69-1 is the registry number for 5-Hydrazinylisophthalic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-hydrazinylbenzene-1,3-dicarboxylic acid (CAS 121385-69-1) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 5-hydrazinylbenzene-1,3-dicarboxylic acid. InChIKey: RPVVTFIXGGRKET-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 5-hydrazinylbenzene-1,3-dicarboxylic acid |
| InChIKey | RPVVTFIXGGRKET-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)NN)C(=O)O |
Computed by PubChem (NCBI)