Products 1214328-02-5

CAS 1214328-02-5 is the registry number for 2-(3-Fluoro-4-methoxyphenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3-fluoro-4-methoxyphenyl)-2-hydroxyacetic acid (CAS 1214328-02-5) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: 2-(3-fluoro-4-methoxyphenyl)-2-hydroxyacetic acid. InChIKey: WRGQYVLQSHKFAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO4
Molecular weight200.16 g/mol
IUPAC name2-(3-fluoro-4-methoxyphenyl)-2-hydroxyacetic acid
InChIKeyWRGQYVLQSHKFAQ-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(C(=O)O)O)F

Computed by PubChem (NCBI)