Products 1214348-62-5
CAS 1214348-62-5 is the registry number for 4-(Difluoromethyl)-2-(trifluoromethyl)anisole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(difluoromethyl)-1-methoxy-2-(trifluoromethyl)benzene (CAS 1214348-62-5) is a chemical compound with the molecular formula C9H7F5O and a molecular weight of 226.14 g/mol. IUPAC name: 4-(difluoromethyl)-1-methoxy-2-(trifluoromethyl)benzene. InChIKey: WBPRBMZDQNTHFU-UHFFFAOYSA-N.
| Molecular formula | C9H7F5O |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 4-(difluoromethyl)-1-methoxy-2-(trifluoromethyl)benzene |
| InChIKey | WBPRBMZDQNTHFU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)F)C(F)(F)F |
Computed by PubChem (NCBI)