CAS 14038-06-3 appears in our catalog under these names: 1-Methoxy-4-(pentafluoroethyl)benzene 95%, 1-Methoxy-4-(pentafluoroethyl)benzene, 95%, 95%, 1-Methoxy-4-(pentafluoroethyl)benzene. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-methoxy-4-(1,1,2,2,2-pentafluoroethyl)benzene (CAS 14038-06-3) is a chemical compound with the molecular formula C9H7F5O and a molecular weight of 226.14 g/mol. IUPAC name: 1-methoxy-4-(1,1,2,2,2-pentafluoroethyl)benzene. InChIKey: OYAYJSSZNWHFQH-UHFFFAOYSA-N.
| Molecular formula | C9H7F5O |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 1-methoxy-4-(1,1,2,2,2-pentafluoroethyl)benzene |
| InChIKey | OYAYJSSZNWHFQH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)