CAS 857297-30-4 is the registry number for (4-(Pentafluoroethyl)phenyl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methanol (CAS 857297-30-4) is a chemical compound with the molecular formula C9H7F5O and a molecular weight of 226.14 g/mol. IUPAC name: [4-(1,1,2,2,2-pentafluoroethyl)phenyl]methanol. InChIKey: ZXZLUFRIKQUNAX-UHFFFAOYSA-N.
| Molecular formula | C9H7F5O |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | [4-(1,1,2,2,2-pentafluoroethyl)phenyl]methanol |
| InChIKey | ZXZLUFRIKQUNAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)