CAS 1988-60-9 is the registry number for 1-(Pentafluorophenyl)-2-propanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(2,3,4,5,6-pentafluorophenyl)propan-2-ol (CAS 1988-60-9) is a chemical compound with the molecular formula C9H7F5O and a molecular weight of 226.14 g/mol. IUPAC name: 1-(2,3,4,5,6-pentafluorophenyl)propan-2-ol. InChIKey: VENFBZQYBFCNLS-UHFFFAOYSA-N.
| Molecular formula | C9H7F5O |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentafluorophenyl)propan-2-ol |
| InChIKey | VENFBZQYBFCNLS-UHFFFAOYSA-N |
| SMILES | CC(CC1=C(C(=C(C(=C1F)F)F)F)F)O |
Computed by PubChem (NCBI)