Products 1247482-83-2
CAS 1247482-83-2 is the registry number for 2-(2,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol (CAS 1247482-83-2) is a chemical compound with the molecular formula C9H7F5O and a molecular weight of 226.14 g/mol. IUPAC name: 2-(2,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol. InChIKey: HNNCLLXCFIFOJX-UHFFFAOYSA-N.
| Molecular formula | C9H7F5O |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol |
| InChIKey | HNNCLLXCFIFOJX-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC=C1F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)