Products 1781643-18-2
CAS 1781643-18-2 appears in our catalog under these names: 2，2–difluoro–2–(3–(trifluoromethyl)phenyl)ethan–1–ol, 2,2-Difluoro-2-[3-(trifluoromethyl)phenyl]ethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2,2-difluoro-2-[3-(trifluoromethyl)phenyl]ethanol (CAS 1781643-18-2) is a chemical compound with the molecular formula C9H7F5O and a molecular weight of 226.14 g/mol. IUPAC name: 2,2-difluoro-2-[3-(trifluoromethyl)phenyl]ethanol. InChIKey: OZRVNYKALIULKM-UHFFFAOYSA-N.
| Molecular formula | C9H7F5O |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 2,2-difluoro-2-[3-(trifluoromethyl)phenyl]ethanol |
| InChIKey | OZRVNYKALIULKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(CO)(F)F |
Computed by PubChem (NCBI)