Products 1214353-57-7
CAS 1214353-57-7 appears in our catalog under these names: Methyl 3–fluoro–2–nitrobenzoate, Methyl 3-fluoro-2-nitrobenzoate 98%, Methyl 3-fluoro-2-nitrobenzoate, 98%, 98%, Methyl 3-Fluoro-2-nitrobenzoate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g, 500g.
Methyl 3-fluoro-2-nitrobenzoate (CAS 1214353-57-7) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: methyl 3-fluoro-2-nitrobenzoate. InChIKey: CAEZBCWSCZBLRF-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | methyl 3-fluoro-2-nitrobenzoate |
| InChIKey | CAEZBCWSCZBLRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)