CAS 1214370-72-5 appears in our catalog under these names: 3-(Trifluoromethyl)-(1,1'-biphenyl)-4-carboxylic acid, 4-phenyl-2-(trifluoromethyl)benzoic acid, ≥95%, ≥95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 1g.
4-phenyl-2-(trifluoromethyl)benzoic acid (CAS 1214370-72-5) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 4-phenyl-2-(trifluoromethyl)benzoic acid. InChIKey: FNUZPUYKDLEJNR-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 4-phenyl-2-(trifluoromethyl)benzoic acid |
| InChIKey | FNUZPUYKDLEJNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)