CAS 1215208-59-5 appears in our catalog under these names: MPT0B014, MPT0B014, 97%, MPT0B014/ 99.56% (existing batch purity), MPT0B014 99%, Quinolin-6-yl(3,4,5-trimethoxyphenyl)methanone, 99%, 99%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 5 mg, 10mM/1mL.
Quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone (CAS 1215208-59-5) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone. InChIKey: GSGXITQZCMSYKF-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone |
| InChIKey | GSGXITQZCMSYKF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)C2=CC3=C(C=C2)N=CC=C3 |
Computed by PubChem (NCBI)