Products 1215404-47-9
CAS 1215404-47-9 appears in our catalog under these names: Metoprolol Acid-d5 (>90%), Metoprolol Acid–d5, Metoprolol Acid-d5. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2-[4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetic acid (CAS 1215404-47-9) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 272.35 g/mol. IUPAC name: 2-[4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetic acid. InChIKey: PUQIRTNPJRFRCZ-FPWSDNDASA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 272.35 g/mol |
| IUPAC name | 2-[4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetic acid |
| InChIKey | PUQIRTNPJRFRCZ-FPWSDNDASA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=C(C=C1)CC(=O)O)O)NC(C)C |
Computed by PubChem (NCBI)