Products 1215602-82-6
CAS 1215602-82-6 appears in our catalog under these names: Carisoprodol-d3, >95% (HPLC), Carisoprodol-d3. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 5mg, 10mg, 50mg.
[2-(carbamoyloxymethyl)-2-(trideuteriomethyl)pentyl] N-propan-2-ylcarbamate (CAS 1215602-82-6) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 263.35 g/mol. IUPAC name: [2-(carbamoyloxymethyl)-2-(trideuteriomethyl)pentyl] N-propan-2-ylcarbamate. InChIKey: OFZCIYFFPZCNJE-GKOSEXJESA-N.
| Molecular formula | C12H24N2O4 |
|---|---|
| Molecular weight | 263.35 g/mol |
| IUPAC name | [2-(carbamoyloxymethyl)-2-(trideuteriomethyl)pentyl] N-propan-2-ylcarbamate |
| InChIKey | OFZCIYFFPZCNJE-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])C(CCC)(COC(=O)N)COC(=O)NC(C)C |
Computed by PubChem (NCBI)