CAS 1218911-01-3 is the registry number for (±)-Carisoprodol-d7 (iso-propyl-d7), 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,01g, 0,005g.
[2-(carbamoyloxymethyl)-2-methylpentyl] N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)carbamate (CAS 1218911-01-3) is a chemical compound with the molecular formula C12H24N2O4 and a molecular weight of 267.37 g/mol. IUPAC name: [2-(carbamoyloxymethyl)-2-methylpentyl] N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)carbamate. InChIKey: OFZCIYFFPZCNJE-DNDFCSDFSA-N.
| Molecular formula | C12H24N2O4 |
|---|---|
| Molecular weight | 267.37 g/mol |
| IUPAC name | [2-(carbamoyloxymethyl)-2-methylpentyl] N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)carbamate |
| InChIKey | OFZCIYFFPZCNJE-DNDFCSDFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC(=O)OCC(C)(CCC)COC(=O)N |
Computed by PubChem (NCBI)