Products 1215609-58-7
CAS 1215609-58-7 is the registry number for 4-[(3-Chlorobenzyl)oxy]-1h-indole-2-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-[(3-chlorophenyl)methoxy]-1H-indole-2-carboxylic acid (CAS 1215609-58-7) is a chemical compound with the molecular formula C16H12ClNO3 and a molecular weight of 301.72 g/mol. IUPAC name: 4-[(3-chlorophenyl)methoxy]-1H-indole-2-carboxylic acid. InChIKey: YVTPCSOMOPZVDF-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO3 |
|---|---|
| Molecular weight | 301.72 g/mol |
| IUPAC name | 4-[(3-chlorophenyl)methoxy]-1H-indole-2-carboxylic acid |
| InChIKey | YVTPCSOMOPZVDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)COC2=CC=CC3=C2C=C(N3)C(=O)O |
Computed by PubChem (NCBI)