Products 1329840-53-0
CAS 1329840-53-0 is the registry number for Benoxaprofen-13C,d3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 50mg, 25 mg, 2.5 mg.
2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]-3,3,3-trideuterio(313C)propanoic acid (CAS 1329840-53-0) is a chemical compound with the molecular formula C16H12ClNO3 and a molecular weight of 305.73 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]-3,3,3-trideuterio(313C)propanoic acid. InChIKey: MITFXPHMIHQXPI-KQORAOOSSA-N.
| Molecular formula | C16H12ClNO3 |
|---|---|
| Molecular weight | 305.73 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]-3,3,3-trideuterio(313C)propanoic acid |
| InChIKey | MITFXPHMIHQXPI-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])C(C1=CC2=C(C=C1)OC(=N2)C3=CC=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)