CAS 797780-71-3 is the registry number for DJ-1-IN-1, 98.60%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10mM/1mL, 10 mg, 50 mg, 100 mg, 25 mg.
1-[2-(2-chlorophenoxy)ethyl]indole-2,3-dione (CAS 797780-71-3) is a chemical compound with the molecular formula C16H12ClNO3 and a molecular weight of 301.72 g/mol. IUPAC name: 1-[2-(2-chlorophenoxy)ethyl]indole-2,3-dione. InChIKey: WQTRWQQRKDITBN-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO3 |
|---|---|
| Molecular weight | 301.72 g/mol |
| IUPAC name | 1-[2-(2-chlorophenoxy)ethyl]indole-2,3-dione |
| InChIKey | WQTRWQQRKDITBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)N2CCOC3=CC=CC=C3Cl |
Computed by PubChem (NCBI)