CAS 1245646-74-5 appears in our catalog under these names: Methyl 3-(7-chloro-1-oxoisoindolin-2-yl)benzoate, 95+%, Methyl 3-(7-chloro-1-oxoisoindolin-2-yl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 3-(4-chloro-3-oxo-1H-isoindol-2-yl)benzoate (CAS 1245646-74-5) is a chemical compound with the molecular formula C16H12ClNO3 and a molecular weight of 301.72 g/mol. IUPAC name: methyl 3-(4-chloro-3-oxo-1H-isoindol-2-yl)benzoate. InChIKey: GRTJZIYUVGAQLO-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO3 |
|---|---|
| Molecular weight | 301.72 g/mol |
| IUPAC name | methyl 3-(4-chloro-3-oxo-1H-isoindol-2-yl)benzoate |
| InChIKey | GRTJZIYUVGAQLO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)N2CC3=C(C2=O)C(=CC=C3)Cl |
Computed by PubChem (NCBI)