Products 1391054-57-1

CAS 1391054-57-1 is the registry number for alpha-Desmethyl Benoxaprofen Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

Methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetate (CAS 1391054-57-1) is a chemical compound with the molecular formula C16H12ClNO3 and a molecular weight of 301.72 g/mol. IUPAC name: methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetate. InChIKey: FLAHKXNYFXNLHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12ClNO3
Molecular weight301.72 g/mol
IUPAC namemethyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetate
InChIKeyFLAHKXNYFXNLHZ-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC2=C(C=C1)OC(=N2)C3=CC=C(C=C3)Cl

Computed by PubChem (NCBI)