CAS 1391054-57-1 is the registry number for alpha-Desmethyl Benoxaprofen Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
Methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetate (CAS 1391054-57-1) is a chemical compound with the molecular formula C16H12ClNO3 and a molecular weight of 301.72 g/mol. IUPAC name: methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetate. InChIKey: FLAHKXNYFXNLHZ-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO3 |
|---|---|
| Molecular weight | 301.72 g/mol |
| IUPAC name | methyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetate |
| InChIKey | FLAHKXNYFXNLHZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC2=C(C=C1)OC(=N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)