CAS 727368-76-5 appears in our catalog under these names: 2-[2-(2-Chlorophenoxy)ethyl]-2,3-dihydro-1h-isoindole-1,3-dione, 95%, 2-(2-(2-Chlorophenoxy)ethyl)-2,3-dihydro-1H-isoindole-1,3-dione, 95%, 2-(2-(2-Chlorophenoxy)ethyl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-[2-(2-chlorophenoxy)ethyl]isoindole-1,3-dione (CAS 727368-76-5) is a chemical compound with the molecular formula C16H12ClNO3 and a molecular weight of 301.72 g/mol. IUPAC name: 2-[2-(2-chlorophenoxy)ethyl]isoindole-1,3-dione. InChIKey: RQRFJWZCYBTJAU-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO3 |
|---|---|
| Molecular weight | 301.72 g/mol |
| IUPAC name | 2-[2-(2-chlorophenoxy)ethyl]isoindole-1,3-dione |
| InChIKey | RQRFJWZCYBTJAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCOC3=CC=CC=C3Cl |
Computed by PubChem (NCBI)