CAS 1219978-61-6 is the registry number for 2,2-Difluoro-6-methoxy-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-6-methoxy-3,4-dihydronaphthalen-1-one (CAS 1219978-61-6) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 2,2-difluoro-6-methoxy-3,4-dihydronaphthalen-1-one. InChIKey: BJEJYHUHCGULPG-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 2,2-difluoro-6-methoxy-3,4-dihydronaphthalen-1-one |
| InChIKey | BJEJYHUHCGULPG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C(CC2)(F)F |
Computed by PubChem (NCBI)