CAS 676500-50-8 is the registry number for 2,3,5-Trifluoro-4-hydroxybenzaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,3,5-trifluoro-4-hydroxybenzaldehyde (CAS 676500-50-8) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,3,5-trifluoro-4-hydroxybenzaldehyde. InChIKey: REUGHNLRBWDCNF-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,3,5-trifluoro-4-hydroxybenzaldehyde |
| InChIKey | REUGHNLRBWDCNF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)O)F)F)C=O |
Computed by PubChem (NCBI)