CAS 393-40-8 appears in our catalog under these names: 2-(Trifluoromethyl)cyclohexa-2,5-diene-1,4-dione, 95%, 2-(Trifluoromethyl)cyclohexa-2,5-diene-1,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dione (CAS 393-40-8) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dione. InChIKey: IFNVAFSTWNJVTQ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | IFNVAFSTWNJVTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C(=CC1=O)C(F)(F)F |
Computed by PubChem (NCBI)