CAS 1237454-77-1 is the registry number for 2,2,4-Trifluorobenzo[d][1,3]dioxole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,4-trifluoro-1,3-benzodioxole (CAS 1237454-77-1) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,2,4-trifluoro-1,3-benzodioxole. InChIKey: WLOGJHAOFXFAEV-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,2,4-trifluoro-1,3-benzodioxole |
| InChIKey | WLOGJHAOFXFAEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)OC(O2)(F)F |
Computed by PubChem (NCBI)