CAS 1216490-04-8 is the registry number for 1-(4-(1H-1,2,4-Triazol-1-yl)phenyl)ethanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine;hydrochloride (CAS 1216490-04-8) is a chemical compound with the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. IUPAC name: 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine;hydrochloride. InChIKey: NNLHEMRJXSWRHO-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4 |
|---|---|
| Molecular weight | 224.69 g/mol |
| IUPAC name | 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine;hydrochloride |
| InChIKey | NNLHEMRJXSWRHO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)N2C=NC=N2)N.Cl |
Computed by PubChem (NCBI)