CAS 1394040-44-8 appears in our catalog under these names: 1-(1-Phenyl-1H-1,2,3-triazol-4-yl)ethan-1-amine hydrochloride, 95%, 1-(1-Phenyl-1H-1,2,3-triazol-4-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(1-phenyltriazol-4-yl)ethanamine;hydrochloride (CAS 1394040-44-8) is a chemical compound with the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. IUPAC name: 1-(1-phenyltriazol-4-yl)ethanamine;hydrochloride. InChIKey: MOWDGWFFMXIISD-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4 |
|---|---|
| Molecular weight | 224.69 g/mol |
| IUPAC name | 1-(1-phenyltriazol-4-yl)ethanamine;hydrochloride |
| InChIKey | MOWDGWFFMXIISD-UHFFFAOYSA-N |
| SMILES | CC(C1=CN(N=N1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)