CAS 2654003-58-2 is the registry number for 6-Chloro-9-isopropyl-2,8-dimethyl-9H-purine, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 250mg, 1g.
6-chloro-2,8-dimethyl-9-propan-2-ylpurine (CAS 2654003-58-2) is a chemical compound with the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. IUPAC name: 6-chloro-2,8-dimethyl-9-propan-2-ylpurine. InChIKey: MYZPFMGTVXPOGO-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4 |
|---|---|
| Molecular weight | 224.69 g/mol |
| IUPAC name | 6-chloro-2,8-dimethyl-9-propan-2-ylpurine |
| InChIKey | MYZPFMGTVXPOGO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)Cl)N=C(N2C(C)C)C |
Computed by PubChem (NCBI)