CAS 1423031-38-2 appears in our catalog under these names: (3-(5-Methyl-1H-1,2,4-triazol-3-yl)phenyl)methanamine hydrochloride, 95%, (3-(5-Methyl-1H-1,2,4-triazol-3-yl)phenyl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine;hydrochloride (CAS 1423031-38-2) is a chemical compound with the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. IUPAC name: [3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine;hydrochloride. InChIKey: RHJMBXHNZYQVOE-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4 |
|---|---|
| Molecular weight | 224.69 g/mol |
| IUPAC name | [3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine;hydrochloride |
| InChIKey | RHJMBXHNZYQVOE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)C2=CC=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)