CAS 1607291-00-8 appears in our catalog under these names: 1-Phenyl-2-(4H-1,2,4-triazol-3-yl)ethan-1-amine hydrochloride, 95%, 1-Phenyl-2-(4H-1,2,4-triazol-3-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride (CAS 1607291-00-8) is a chemical compound with the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. IUPAC name: 1-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride. InChIKey: JVTREJTURHQEEI-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4 |
|---|---|
| Molecular weight | 224.69 g/mol |
| IUPAC name | 1-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride |
| InChIKey | JVTREJTURHQEEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC2=NC=NN2)N.Cl |
Computed by PubChem (NCBI)