CAS 2225141-21-7 appears in our catalog under these names: (4-(5-Methyl-1H-1,2,4-triazol-3-yl)phenyl)methanamine hydrochloride, 98%, (4-(5-Methyl-1H-1,2,4-triazol-3-yl)phenyl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine;hydrochloride (CAS 2225141-21-7) is a chemical compound with the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. IUPAC name: [4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine;hydrochloride. InChIKey: QMBVMLQKYTXRLV-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4 |
|---|---|
| Molecular weight | 224.69 g/mol |
| IUPAC name | [4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine;hydrochloride |
| InChIKey | QMBVMLQKYTXRLV-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)