Products 1216588-60-1
CAS 1216588-60-1 appears in our catalog under these names: 4-Methyl Hippuric Acid-d7, >95% (HPLC), N-(4-Methyl-d3-benzoyl-d4)glycine, 98 atom % D, min 98% Chemical Purity, 4–Methylhippuric acid–d7, 4-Methylhippuric acid-d7. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 0,1g, 0,05g, 5 mg.
2-[[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzoyl]amino]acetic acid (CAS 1216588-60-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 200.24 g/mol. IUPAC name: 2-[[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzoyl]amino]acetic acid. InChIKey: NRSCPTLHWVWLLH-AAYPNNLASA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 2-[[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzoyl]amino]acetic acid |
| InChIKey | NRSCPTLHWVWLLH-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)NCC(=O)O)[2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)